C22H28N4O7S2 — CID 91410364
(2S)-2-(benzenesulfonamido)-3-[3-hydroxy-4-(3-hydroxy-1,1-dioxo-2H-1,2,5-thiadiazol-5-yl)phenyl]-N-pentylpropanamide (PubChem CID 91410364) has the molecular formula C22H28N4O7S2 and a molecular weight of 524.62 g/mol. Its IUPAC name is (2S)-2-(benzenesulfonamido)-3-[3-hydroxy-4-(3-hydroxy-1,1-dioxo-2H-1,2,5-thiadiazol-5-yl)phenyl]-N-pentylpropanamide.
| Compound Name | (2S)-2-(benzenesulfonamido)-3-[3-hydroxy-4-(3-hydroxy-1,1-dioxo-2H-1,2,5-thiadiazol-5-yl)phenyl]-N-pentylpropanamide |
|---|---|
| PubChem CID | 91410364 |
| Molecular Formula | C22H28N4O7S2 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | (2S)-2-(benzenesulfonamido)-3-[3-hydroxy-4-(3-hydroxy-1,1-dioxo-2H-1,2,5-thiadiazol-5-yl)phenyl]-N-pentylpropanamide |
| SMILES | CCCCCNC(=O)[C@H](Cc1ccc(N2C=C(O)NS2(=O)=O)c(O)c1)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H28N4O7S2/c1-2-3-7-12-23-22(29)18(24-34(30,31)17-8-5-4-6-9-17)13-16-10-11-19(20(27)14-16)26-15-21(28)25-35(26,32)33/h4-6,8-11,14-15,18,24-25,27-28H,2-3,7,12-13H2,1H3,(H,23,29)/t18-/m0/s1 |
| InChIKey | WMJPBMHSXZQFFM-SFHVURJKSA-N |
| XLogP | 1.60 |
| TPSA | 165.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|