C16H20N2O4S — CID 91413479
(2R,3aR,6aR)-N-hydroxy-1-(2-phenylethenylsulfonyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxamide (PubChem CID 91413479) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is (2R,3aR,6aR)-N-hydroxy-1-(2-phenylethenylsulfonyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxamide.
| Compound Name | (2R,3aR,6aR)-N-hydroxy-1-(2-phenylethenylsulfonyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 91413479 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | (2R,3aR,6aR)-N-hydroxy-1-(2-phenylethenylsulfonyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxamide |
| SMILES | O=C(NO)[C@H]1C[C@H]2CCC[C@H]2N1S(=O)(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C16H20N2O4S/c19-16(17-20)15-11-13-7-4-8-14(13)18(15)23(21,22)10-9-12-5-2-1-3-6-12/h1-3,5-6,9-10,13-15,20H,4,7-8,11H2,(H,17,19)/t13-,14-,15-/m1/s1 |
| InChIKey | LKMHTQRWTLMTOW-RBSFLKMASA-N |
| XLogP | 1.74 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|