C16H21FN2O3S — CID 129353363
(3R,3aR,6aR)-2-[(2-fluoro-4-methylphenyl)methylsulfonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide (PubChem CID 129353363) has the molecular formula C16H21FN2O3S and a molecular weight of 340.42 g/mol. Its IUPAC name is (3R,3aR,6aR)-2-[(2-fluoro-4-methylphenyl)methylsulfonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | (3R,3aR,6aR)-2-[(2-fluoro-4-methylphenyl)methylsulfonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 129353363 |
| Molecular Formula | C16H21FN2O3S |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | (3R,3aR,6aR)-2-[(2-fluoro-4-methylphenyl)methylsulfonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
| SMILES | Cc1ccc(CS(=O)(=O)N2C[C@@H]3CCC[C@H]3[C@@H]2C(N)=O)c(F)c1 |
| InChI | InChI=1S/C16H21FN2O3S/c1-10-5-6-12(14(17)7-10)9-23(21,22)19-8-11-3-2-4-13(11)15(19)16(18)20/h5-7,11,13,15H,2-4,8-9H2,1H3,(H2,18,20)/t11-,13+,15+/m0/s1 |
| InChIKey | BAWNFKOCFFOKDS-NJZAAPMLSA-N |
| XLogP | 1.55 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |