C27H35N3O4 — CID 91414122
(3aS,3bS,9aS,9bR,11aS)-6,9a,11a-trimethyl-N-[(3-nitrophenyl)methyl]-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinoline-8-carboxamide (PubChem CID 91414122) has the molecular formula C27H35N3O4 and a molecular weight of 465.59 g/mol. Its IUPAC name is (3aS,3bS,9aS,9bR,11aS)-6,9a,11a-trimethyl-N-[(3-nitrophenyl)methyl]-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinoline-8-carboxamide.
| Compound Name | (3aS,3bS,9aS,9bR,11aS)-6,9a,11a-trimethyl-N-[(3-nitrophenyl)methyl]-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 91414122 |
| Molecular Formula | C27H35N3O4 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | (3aS,3bS,9aS,9bR,11aS)-6,9a,11a-trimethyl-N-[(3-nitrophenyl)methyl]-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinoline-8-carboxamide |
| SMILES | CN1C(=O)C(C(=O)NCc2cccc([N+](=O)[O-])c2)=C[C@@]2(C)C1CC[C@@H]1[C@H]2CC[C@]2(C)CCC[C@@H]12 |
| InChI | InChI=1S/C27H35N3O4/c1-26-12-5-8-21(26)19-9-10-23-27(2,22(19)11-13-26)15-20(25(32)29(23)3)24(31)28-16-17-6-4-7-18(14-17)30(33)34/h4,6-7,14-15,19,21-23H,5,8-13,16H2,1-3H3,(H,28,31)/t19-,21-,22+,23?,26-,27+/m0/s1 |
| InChIKey | TWSFGRPSJRKQFB-RZCVHGIQSA-N |
| XLogP | 4.61 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|