C27H38N2O4 — CID 22862551
(3aS,3bS,5aR,9aR,9bS,11aS)-6,9a,11a-trimethyl-1-[(3-nitrophenyl)methoxymethyl]-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one (PubChem CID 22862551) has the molecular formula C27H38N2O4 and a molecular weight of 454.61 g/mol. Its IUPAC name is (3aS,3bS,5aR,9aR,9bS,11aS)-6,9a,11a-trimethyl-1-[(3-nitrophenyl)methoxymethyl]-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one.
| Compound Name | (3aS,3bS,5aR,9aR,9bS,11aS)-6,9a,11a-trimethyl-1-[(3-nitrophenyl)methoxymethyl]-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 22862551 |
| Molecular Formula | C27H38N2O4 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | (3aS,3bS,5aR,9aR,9bS,11aS)-6,9a,11a-trimethyl-1-[(3-nitrophenyl)methoxymethyl]-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one |
| SMILES | CN1C(=O)CC[C@]2(C)[C@H]3CC[C@]4(C)C(COCc5cccc([N+](=O)[O-])c5)CC[C@H]4[C@@H]3CC[C@@H]12 |
| InChI | InChI=1S/C27H38N2O4/c1-26-13-11-23-21(8-10-24-27(23,2)14-12-25(30)28(24)3)22(26)9-7-19(26)17-33-16-18-5-4-6-20(15-18)29(31)32/h4-6,15,19,21-24H,7-14,16-17H2,1-3H3/t19?,21-,22-,23-,24+,26+,27+/m0/s1 |
| InChIKey | LMYGWCXYYCWIDR-UXYLUBMBSA-N |
| XLogP | 5.59 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|