C20H13F3O5 — CID 91415917
2-[[5-[2-(trifluoromethyl)phenyl]furan-2-yl]methyl]-1-benzofuran-3,6,7-triol (PubChem CID 91415917) has the molecular formula C20H13F3O5 and a molecular weight of 390.31 g/mol. Its IUPAC name is 2-[[5-[2-(trifluoromethyl)phenyl]furan-2-yl]methyl]-1-benzofuran-3,6,7-triol.
| Compound Name | 2-[[5-[2-(trifluoromethyl)phenyl]furan-2-yl]methyl]-1-benzofuran-3,6,7-triol |
|---|---|
| PubChem CID | 91415917 |
| Molecular Formula | C20H13F3O5 |
| Molecular Weight | 390.31 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 2-[[5-[2-(trifluoromethyl)phenyl]furan-2-yl]methyl]-1-benzofuran-3,6,7-triol |
| SMILES | Oc1ccc2c(O)c(Cc3ccc(-c4ccccc4C(F)(F)F)o3)oc2c1O |
| InChI | InChI=1S/C20H13F3O5/c21-20(22,23)13-4-2-1-3-11(13)15-8-5-10(27-15)9-16-17(25)12-6-7-14(24)18(26)19(12)28-16/h1-8,24-26H,9H2 |
| InChIKey | VIYFTLOENFOIRX-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 86.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.31 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|