C26H36N2O8 — CID 91416381
diethyl (1S,2R,4S,5S,6R)-4-[(2-methoxyphenyl)carbamoyl]-1-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]bicyclo[3.1.0]hexane-2,6-dicarboxylate (PubChem CID 91416381) has the molecular formula C26H36N2O8 and a molecular weight of 504.58 g/mol. Its IUPAC name is diethyl (1S,2R,4S,5S,6R)-4-[(2-methoxyphenyl)carbamoyl]-1-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]bicyclo[3.1.0]hexane-2,6-dicarboxylate.
| Compound Name | diethyl (1S,2R,4S,5S,6R)-4-[(2-methoxyphenyl)carbamoyl]-1-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]bicyclo[3.1.0]hexane-2,6-dicarboxylate |
|---|---|
| PubChem CID | 91416381 |
| Molecular Formula | C26H36N2O8 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | diethyl (1S,2R,4S,5S,6R)-4-[(2-methoxyphenyl)carbamoyl]-1-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]bicyclo[3.1.0]hexane-2,6-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H]2[C@@H](C(=O)Nc3ccccc3OC)C[C@](NC(=O)OC(C)(C)C)(C(=O)OCC)[C@@]21C |
| InChI | InChI=1S/C26H36N2O8/c1-8-34-21(30)19-18-15(20(29)27-16-12-10-11-13-17(16)33-7)14-26(25(18,19)6,22(31)35-9-2)28-23(32)36-24(3,4)5/h10-13,15,18-19H,8-9,14H2,1-7H3,(H,27,29)(H,28,32)/t15-,18-,19-,25-,26-/m0/s1 |
| InChIKey | YOHBNLUQYGYWER-WCHZJDQESA-N |
| XLogP | 3.30 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|