C12H13NO — CID 91417064
phenyl(2,3,4,5-tetrahydropyridin-2-yl)methanone (PubChem CID 91417064) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is phenyl(2,3,4,5-tetrahydropyridin-2-yl)methanone.
| Compound Name | phenyl(2,3,4,5-tetrahydropyridin-2-yl)methanone |
|---|---|
| PubChem CID | 91417064 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | phenyl(2,3,4,5-tetrahydropyridin-2-yl)methanone |
| SMILES | O=C(c1ccccc1)C1CCCC=N1 |
| InChI | InChI=1S/C12H13NO/c14-12(10-6-2-1-3-7-10)11-8-4-5-9-13-11/h1-3,6-7,9,11H,4-5,8H2 |
| InChIKey | LCXBWUCFHHURFW-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |