C17H31O2P — CID 91417184
(5R,6S)-3-tert-butyl-5,9,9-trimethyl-6-phosphanyloxydeca-3,7-dienal (PubChem CID 91417184) has the molecular formula C17H31O2P and a molecular weight of 298.41 g/mol. Its IUPAC name is (5R,6S)-3-tert-butyl-5,9,9-trimethyl-6-phosphanyloxydeca-3,7-dienal.
| Compound Name | (5R,6S)-3-tert-butyl-5,9,9-trimethyl-6-phosphanyloxydeca-3,7-dienal |
|---|---|
| PubChem CID | 91417184 |
| Molecular Formula | C17H31O2P |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | (5R,6S)-3-tert-butyl-5,9,9-trimethyl-6-phosphanyloxydeca-3,7-dienal |
| SMILES | C[C@H](C=C(CC=O)C(C)(C)C)[C@H](C=CC(C)(C)C)OP |
| InChI | InChI=1S/C17H31O2P/c1-13(12-14(9-11-18)17(5,6)7)15(19-20)8-10-16(2,3)4/h8,10-13,15H,9,20H2,1-7H3/t13-,15+/m1/s1 |
| InChIKey | SXBXWUIJJJRXJR-HIFRSBDPSA-N |
| XLogP | 4.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|