C15H28O3 — CID 142140821
(E)-3,4-dihydroxy-5,8,8-trimethyl-2-propan-2-ylnon-6-enal (PubChem CID 142140821) has the molecular formula C15H28O3 and a molecular weight of 256.39 g/mol. Its IUPAC name is (E)-3,4-dihydroxy-5,8,8-trimethyl-2-propan-2-ylnon-6-enal.
| Compound Name | (E)-3,4-dihydroxy-5,8,8-trimethyl-2-propan-2-ylnon-6-enal |
|---|---|
| PubChem CID | 142140821 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | (E)-3,4-dihydroxy-5,8,8-trimethyl-2-propan-2-ylnon-6-enal |
| SMILES | CC(C)C(C=O)C(O)C(O)C(C)/C=C/C(C)(C)C |
| InChI | InChI=1S/C15H28O3/c1-10(2)12(9-16)14(18)13(17)11(3)7-8-15(4,5)6/h7-14,17-18H,1-6H3/b8-7+ |
| InChIKey | FHDZYKDZVAADQD-BQYQJAHWSA-N |
| XLogP | 2.42 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|