C26H22N2O7 — CID 91417553
1-ethoxypyrrole-2,5-dione;2-[(4-methoxynaphthalen-1-yl)methoxy]isoindole-1,3-dione (PubChem CID 91417553) has the molecular formula C26H22N2O7 and a molecular weight of 474.47 g/mol. Its IUPAC name is 1-ethoxypyrrole-2,5-dione;2-[(4-methoxynaphthalen-1-yl)methoxy]isoindole-1,3-dione.
| Compound Name | 1-ethoxypyrrole-2,5-dione;2-[(4-methoxynaphthalen-1-yl)methoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 91417553 |
| Molecular Formula | C26H22N2O7 |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 1-ethoxypyrrole-2,5-dione;2-[(4-methoxynaphthalen-1-yl)methoxy]isoindole-1,3-dione |
| SMILES | CCON1C(=O)C=CC1=O.COc1ccc(CON2C(=O)c3ccccc3C2=O)c2ccccc12 |
| InChI | InChI=1S/C20H15NO4.C6H7NO3/c1-24-18-11-10-13(14-6-2-3-7-15(14)18)12-25-21-19(22)16-8-4-5-9-17(16)20(21)23;1-2-10-7-5(8)3-4-6(7)9/h2-11H,12H2,1H3;3-4H,2H2,1H3 |
| InChIKey | UAVANFPAVYVCLJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|