C33H33FN2O2 — CID 91418121
2-fluoro-N-[(1R,2R)-2-hydroxy-6-[(4-phenylbutylamino)methyl]-2,3-dihydro-1H-inden-1-yl]-4-phenylbenzamide (PubChem CID 91418121) has the molecular formula C33H33FN2O2 and a molecular weight of 508.64 g/mol. Its IUPAC name is 2-fluoro-N-[(1R,2R)-2-hydroxy-6-[(4-phenylbutylamino)methyl]-2,3-dihydro-1H-inden-1-yl]-4-phenylbenzamide.
| Compound Name | 2-fluoro-N-[(1R,2R)-2-hydroxy-6-[(4-phenylbutylamino)methyl]-2,3-dihydro-1H-inden-1-yl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 91418121 |
| Molecular Formula | C33H33FN2O2 |
| Molecular Weight | 508.64 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | 2-fluoro-N-[(1R,2R)-2-hydroxy-6-[(4-phenylbutylamino)methyl]-2,3-dihydro-1H-inden-1-yl]-4-phenylbenzamide |
| SMILES | O=C(N[C@@H]1c2cc(CNCCCCc3ccccc3)ccc2C[C@H]1O)c1ccc(-c2ccccc2)cc1F |
| InChI | InChI=1S/C33H33FN2O2/c34-30-20-26(25-12-5-2-6-13-25)16-17-28(30)33(38)36-32-29-19-24(14-15-27(29)21-31(32)37)22-35-18-8-7-11-23-9-3-1-4-10-23/h1-6,9-10,12-17,19-20,31-32,35,37H,7-8,11,18,21-22H2,(H,36,38)/t31-,32-/m1/s1 |
| InChIKey | WIJHOWQQTXFSLV-ROJLCIKYSA-N |
| XLogP | 5.99 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.64 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|