C8H9N — CID 91419055
5,7a-dihydro-3H-indole (PubChem CID 91419055) has the molecular formula C8H9N and a molecular weight of 119.17 g/mol. Its IUPAC name is 5,7a-dihydro-3H-indole.
| Compound Name | 5,7a-dihydro-3H-indole |
|---|---|
| PubChem CID | 91419055 |
| Molecular Formula | C8H9N |
| Molecular Weight | 119.17 g/mol |
| Exact Mass | 119.07 |
| IUPAC Name | 5,7a-dihydro-3H-indole |
| SMILES | C1=CC2N=CCC2=CC1 |
| InChI | InChI=1S/C8H9N/c1-2-4-8-7(3-1)5-6-9-8/h2-4,6,8H,1,5H2 |
| InChIKey | REOIPLWKIRCFGU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 119.17 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|