C14H25NO3 — CID 91420699
ethyl N-(1-ethoxypropyl)-N-hexa-3,5-dien-3-ylcarbamate (PubChem CID 91420699) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is ethyl N-(1-ethoxypropyl)-N-hexa-3,5-dien-3-ylcarbamate.
| Compound Name | ethyl N-(1-ethoxypropyl)-N-hexa-3,5-dien-3-ylcarbamate |
|---|---|
| PubChem CID | 91420699 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | ethyl N-(1-ethoxypropyl)-N-hexa-3,5-dien-3-ylcarbamate |
| SMILES | C=CC=C(CC)N(C(=O)OCC)C(CC)OCC |
| InChI | InChI=1S/C14H25NO3/c1-6-11-12(7-2)15(14(16)18-10-5)13(8-3)17-9-4/h6,11,13H,1,7-10H2,2-5H3 |
| InChIKey | ZRPPSSHLJRFGQA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|