C23H32ClN5O3S — CID 91421654
N-[(4-chlorophenyl)methyl]-8-(3-morpholin-4-ylpropylcarbamothioyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-3-carboxamide (PubChem CID 91421654) has the molecular formula C23H32ClN5O3S and a molecular weight of 494.06 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-8-(3-morpholin-4-ylpropylcarbamothioyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-3-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-8-(3-morpholin-4-ylpropylcarbamothioyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-3-carboxamide |
|---|---|
| PubChem CID | 91421654 |
| Molecular Formula | C23H32ClN5O3S |
| Molecular Weight | 494.06 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-8-(3-morpholin-4-ylpropylcarbamothioyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-3-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)C1=CC2(CCN(C(=S)NCCCN3CCOCC3)CC2)ON1 |
| InChI | InChI=1S/C23H32ClN5O3S/c24-19-4-2-18(3-5-19)17-26-21(30)20-16-23(32-27-20)6-10-29(11-7-23)22(33)25-8-1-9-28-12-14-31-15-13-28/h2-5,16,27H,1,6-15,17H2,(H,25,33)(H,26,30) |
| InChIKey | CWFIOLNBTPBIFB-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.06 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|