C12H12ClFN2O4S — CID 9142202
(3S)-N'-(4-chloro-2-fluorobenzoyl)-1,1-dioxothiolane-3-carbohydrazide (PubChem CID 9142202) has the molecular formula C12H12ClFN2O4S and a molecular weight of 334.76 g/mol. Its IUPAC name is (3S)-N'-(4-chloro-2-fluorobenzoyl)-1,1-dioxothiolane-3-carbohydrazide.
| Compound Name | (3S)-N'-(4-chloro-2-fluorobenzoyl)-1,1-dioxothiolane-3-carbohydrazide |
|---|---|
| PubChem CID | 9142202 |
| Molecular Formula | C12H12ClFN2O4S |
| Molecular Weight | 334.76 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | (3S)-N'-(4-chloro-2-fluorobenzoyl)-1,1-dioxothiolane-3-carbohydrazide |
| SMILES | O=C(NNC(=O)[C@@H]1CCS(=O)(=O)C1)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C12H12ClFN2O4S/c13-8-1-2-9(10(14)5-8)12(18)16-15-11(17)7-3-4-21(19,20)6-7/h1-2,5,7H,3-4,6H2,(H,15,17)(H,16,18)/t7-/m1/s1 |
| InChIKey | WSUXBLLFAOQXLV-SSDOTTSWSA-N |
| XLogP | 0.67 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.76 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|