C9H15N2+ — CID 91426073
(3-ethenyl-1,3-dihydropyrrol-2-ylidene)-ethyl-methylazanium (PubChem CID 91426073) has the molecular formula C9H15N2+ and a molecular weight of 151.23 g/mol. Its IUPAC name is (3-ethenyl-1,3-dihydropyrrol-2-ylidene)-ethyl-methylazanium.
| Compound Name | (3-ethenyl-1,3-dihydropyrrol-2-ylidene)-ethyl-methylazanium |
|---|---|
| PubChem CID | 91426073 |
| Molecular Formula | C9H15N2+ |
| Molecular Weight | 151.23 g/mol |
| Exact Mass | 151.12 |
| IUPAC Name | (3-ethenyl-1,3-dihydropyrrol-2-ylidene)-ethyl-methylazanium |
| SMILES | C=CC1C=CN/C1=[N+](/C)CC |
| InChI | InChI=1S/C9H14N2/c1-4-8-6-7-10-9(8)11(3)5-2/h4,6-8H,1,5H2,2-3H3/p+1 |
| InChIKey | RJVANPAZZZHCPR-UHFFFAOYSA-O |
| XLogP | 0.97 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.23 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|