C23H37N3O5S — CID 91426774
tert-butyl 5-amino-2-[(2-methylbenzoyl)amino]-5-sulfanylidenepentanoate;tert-butyl N-methylcarbamate (PubChem CID 91426774) has the molecular formula C23H37N3O5S and a molecular weight of 467.63 g/mol. Its IUPAC name is tert-butyl 5-amino-2-[(2-methylbenzoyl)amino]-5-sulfanylidenepentanoate;tert-butyl N-methylcarbamate.
| Compound Name | tert-butyl 5-amino-2-[(2-methylbenzoyl)amino]-5-sulfanylidenepentanoate;tert-butyl N-methylcarbamate |
|---|---|
| PubChem CID | 91426774 |
| Molecular Formula | C23H37N3O5S |
| Molecular Weight | 467.63 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | tert-butyl 5-amino-2-[(2-methylbenzoyl)amino]-5-sulfanylidenepentanoate;tert-butyl N-methylcarbamate |
| SMILES | CNC(=O)OC(C)(C)C.Cc1ccccc1C(=O)NC(CCC(N)=S)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H24N2O3S.C6H13NO2/c1-11-7-5-6-8-12(11)15(20)19-13(9-10-14(18)23)16(21)22-17(2,3)4;1-6(2,3)9-5(8)7-4/h5-8,13H,9-10H2,1-4H3,(H2,18,23)(H,19,20);1-4H3,(H,7,8) |
| InChIKey | PXEKRZHXGLWRQS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.63 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|