C21H31NO5S2 — CID 140977674
ditert-butyl 2-[[2-(disulfanyl)benzoyl]amino]hexanedioate (PubChem CID 140977674) has the molecular formula C21H31NO5S2 and a molecular weight of 441.62 g/mol. Its IUPAC name is ditert-butyl 2-[[2-(disulfanyl)benzoyl]amino]hexanedioate.
| Compound Name | ditert-butyl 2-[[2-(disulfanyl)benzoyl]amino]hexanedioate |
|---|---|
| PubChem CID | 140977674 |
| Molecular Formula | C21H31NO5S2 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | ditert-butyl 2-[[2-(disulfanyl)benzoyl]amino]hexanedioate |
| SMILES | CC(C)(C)OC(=O)CCCC(NC(=O)c1ccccc1SS)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H31NO5S2/c1-20(2,3)26-17(23)13-9-11-15(19(25)27-21(4,5)6)22-18(24)14-10-7-8-12-16(14)29-28/h7-8,10,12,15,28H,9,11,13H2,1-6H3,(H,22,24) |
| InChIKey | YUCYHCJXPYAUIQ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|