C11H16N2O — CID 91427416
(1S,2S,3R,4R)-3-amino-N-cyclopropylbicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 91427416) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is (1S,2S,3R,4R)-3-amino-N-cyclopropylbicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1S,2S,3R,4R)-3-amino-N-cyclopropylbicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 91427416 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | (1S,2S,3R,4R)-3-amino-N-cyclopropylbicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | N[C@H]1[C@@H](C(=O)NC2CC2)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C11H16N2O/c12-10-7-2-1-6(5-7)9(10)11(14)13-8-3-4-8/h1-2,6-10H,3-5,12H2,(H,13,14)/t6-,7+,9+,10-/m1/s1 |
| InChIKey | CFVYADZPGRGVDA-GOZTYBTRSA-N |
| XLogP | 0.41 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|