C11H19N2P — CID 91430015
2,4-dimethyl-6,7-dihydro-1,2,4-benzodiazaphosphinin-2-ium-1-ide;ethane (PubChem CID 91430015) has the molecular formula C11H19N2P and a molecular weight of 210.26 g/mol. Its IUPAC name is 2,4-dimethyl-6,7-dihydro-1,2,4-benzodiazaphosphinin-2-ium-1-ide;ethane.
| Compound Name | 2,4-dimethyl-6,7-dihydro-1,2,4-benzodiazaphosphinin-2-ium-1-ide;ethane |
|---|---|
| PubChem CID | 91430015 |
| Molecular Formula | C11H19N2P |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 2,4-dimethyl-6,7-dihydro-1,2,4-benzodiazaphosphinin-2-ium-1-ide;ethane |
| SMILES | CC.C[N+]1=CP(C)C2=CCCC=C2[N-]1 |
| InChI | InChI=1S/C9H13N2P.C2H6/c1-11-7-12(2)9-6-4-3-5-8(9)10-11;1-2/h5-7H,3-4H2,1-2H3;1-2H3 |
| InChIKey | HOMXKKFRVQIHCK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 17.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|