C9H13N2P — CID 91430016
2,4-dimethyl-6,7-dihydro-1,2,4-benzodiazaphosphinin-2-ium-1-ide (PubChem CID 91430016) has the molecular formula C9H13N2P and a molecular weight of 180.19 g/mol. Its IUPAC name is 2,4-dimethyl-6,7-dihydro-1,2,4-benzodiazaphosphinin-2-ium-1-ide.
| Compound Name | 2,4-dimethyl-6,7-dihydro-1,2,4-benzodiazaphosphinin-2-ium-1-ide |
|---|---|
| PubChem CID | 91430016 |
| Molecular Formula | C9H13N2P |
| Molecular Weight | 180.19 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 2,4-dimethyl-6,7-dihydro-1,2,4-benzodiazaphosphinin-2-ium-1-ide |
| SMILES | C[N+]1=CP(C)C2=CCCC=C2[N-]1 |
| InChI | InChI=1S/C9H13N2P/c1-11-7-12(2)9-6-4-3-5-8(9)10-11/h5-7H,3-4H2,1-2H3 |
| InChIKey | UOSNPJOPDFMRBO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 17.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.19 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|