C14H16F3N3O3 — CID 91430167
3-[[3-cyano-6-(trifluoromethyl)-2-pyridinyl]oxy]pentyl-methylcarbamic acid (PubChem CID 91430167) has the molecular formula C14H16F3N3O3 and a molecular weight of 331.29 g/mol. Its IUPAC name is 3-[[3-cyano-6-(trifluoromethyl)-2-pyridinyl]oxy]pentyl-methylcarbamic acid.
| Compound Name | 3-[[3-cyano-6-(trifluoromethyl)-2-pyridinyl]oxy]pentyl-methylcarbamic acid |
|---|---|
| PubChem CID | 91430167 |
| Molecular Formula | C14H16F3N3O3 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 3-[[3-cyano-6-(trifluoromethyl)-2-pyridinyl]oxy]pentyl-methylcarbamic acid |
| SMILES | CCC(CCN(C)C(=O)O)Oc1nc(C(F)(F)F)ccc1C#N |
| InChI | InChI=1S/C14H16F3N3O3/c1-3-10(6-7-20(2)13(21)22)23-12-9(8-18)4-5-11(19-12)14(15,16)17/h4-5,10H,3,6-7H2,1-2H3,(H,21,22) |
| InChIKey | IZAMZXCKLXTXCR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 86.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |