C14H16F3N3O2 — CID 133367282
propan-2-yl 2-[[3-cyano-6-(trifluoromethyl)-2-pyridinyl]-methylamino]propanoate (PubChem CID 133367282) has the molecular formula C14H16F3N3O2 and a molecular weight of 315.30 g/mol. Its IUPAC name is propan-2-yl 2-[[3-cyano-6-(trifluoromethyl)-2-pyridinyl]-methylamino]propanoate.
| Compound Name | propan-2-yl 2-[[3-cyano-6-(trifluoromethyl)-2-pyridinyl]-methylamino]propanoate |
|---|---|
| PubChem CID | 133367282 |
| Molecular Formula | C14H16F3N3O2 |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | propan-2-yl 2-[[3-cyano-6-(trifluoromethyl)-2-pyridinyl]-methylamino]propanoate |
| SMILES | CC(C)OC(=O)C(C)N(C)c1nc(C(F)(F)F)ccc1C#N |
| InChI | InChI=1S/C14H16F3N3O2/c1-8(2)22-13(21)9(3)20(4)12-10(7-18)5-6-11(19-12)14(15,16)17/h5-6,8-9H,1-4H3 |
| InChIKey | KMHZHSCEGVCJDY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 66.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |