C13H21N3O — CID 91430807
N,N-diethyl-3-[[3-(methylideneamino)-2-pyridinyl]oxy]propan-1-amine (PubChem CID 91430807) has the molecular formula C13H21N3O and a molecular weight of 235.33 g/mol. Its IUPAC name is N,N-diethyl-3-[[3-(methylideneamino)-2-pyridinyl]oxy]propan-1-amine.
| Compound Name | N,N-diethyl-3-[[3-(methylideneamino)-2-pyridinyl]oxy]propan-1-amine |
|---|---|
| PubChem CID | 91430807 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | N,N-diethyl-3-[[3-(methylideneamino)-2-pyridinyl]oxy]propan-1-amine |
| SMILES | C=Nc1cccnc1OCCCN(CC)CC |
| InChI | InChI=1S/C13H21N3O/c1-4-16(5-2)10-7-11-17-13-12(14-3)8-6-9-15-13/h6,8-9H,3-5,7,10-11H2,1-2H3 |
| InChIKey | LWDDGMMWCNQNAQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|