C25H46 — CID 91433070
1-(8-ethyl-9-ethynyl-4,8-dimethylpentadecan-2-yl)-2-methylcyclopropane (PubChem CID 91433070) has the molecular formula C25H46 and a molecular weight of 346.64 g/mol. Its IUPAC name is 1-(8-ethyl-9-ethynyl-4,8-dimethylpentadecan-2-yl)-2-methylcyclopropane.
| Compound Name | 1-(8-ethyl-9-ethynyl-4,8-dimethylpentadecan-2-yl)-2-methylcyclopropane |
|---|---|
| PubChem CID | 91433070 |
| Molecular Formula | C25H46 |
| Molecular Weight | 346.64 g/mol |
| Exact Mass | 346.36 |
| IUPAC Name | 1-(8-ethyl-9-ethynyl-4,8-dimethylpentadecan-2-yl)-2-methylcyclopropane |
| SMILES | C#CC(CCCCCC)C(C)(CC)CCCC(C)CC(C)C1CC1C |
| InChI | InChI=1S/C25H46/c1-8-11-12-13-16-23(9-2)25(7,10-3)17-14-15-20(4)18-21(5)24-19-22(24)6/h2,20-24H,8,10-19H2,1,3-7H3 |
| InChIKey | FLEOAGZJBHPAHZ-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.64 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|