About CID 91433916
CID 91433916 (PubChem CID 91433916) has the molecular formula C14H14S
and a molecular weight of 214.33 g/mol.
Molecular Properties
| Compound Name | CID 91433916 |
| PubChem CID | 91433916 |
| Molecular Formula | C14H14S |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | — |
| SMILES | [CH2-]c1ccc(-c2cccs2)cc1C[CH+]C |
| InChI | InChI=1S/C14H14S/c1-3-5-12-10-13(8-7-11(12)2)14-6-4-9-15-14/h3-4,6-10H,2,5H2,1H3 |
| InChIKey | GHKOYFWCLCJWAP-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 91433916 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 91433916?
The IUPAC name of CID 91433916 (CID 91433916) is not available.
What is the SMILES notation for CID 91433916?
The canonical SMILES for CID 91433916 is [CH2-]c1ccc(-c2cccs2)cc1C[CH+]C.
What is the InChIKey of CID 91433916?
The InChIKey is GHKOYFWCLCJWAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14S/c1-3-5-12-10-13(8-7-11(12)2)14-6-4-9-15-14/h3-4,6-10H,2,5H2,1H3.
What are the key properties of CID 91433916?
CID 91433916 has a molecular weight of 214.33 g/mol, XLogP of 4.36, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 91433916 is sourced from PubChem (CID 91433916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).