C20H18FN5O2 — CID 91434682
3-amino-6-[[3-[(2-fluorophenyl)methylcarbamoyl]phenyl]methyl]pyrazine-2-carboxamide (PubChem CID 91434682) has the molecular formula C20H18FN5O2 and a molecular weight of 379.40 g/mol. Its IUPAC name is 3-amino-6-[[3-[(2-fluorophenyl)methylcarbamoyl]phenyl]methyl]pyrazine-2-carboxamide.
| Compound Name | 3-amino-6-[[3-[(2-fluorophenyl)methylcarbamoyl]phenyl]methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 91434682 |
| Molecular Formula | C20H18FN5O2 |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 3-amino-6-[[3-[(2-fluorophenyl)methylcarbamoyl]phenyl]methyl]pyrazine-2-carboxamide |
| SMILES | NC(=O)c1nc(Cc2cccc(C(=O)NCc3ccccc3F)c2)cnc1N |
| InChI | InChI=1S/C20H18FN5O2/c21-16-7-2-1-5-14(16)10-25-20(28)13-6-3-4-12(8-13)9-15-11-24-18(22)17(26-15)19(23)27/h1-8,11H,9-10H2,(H2,22,24)(H2,23,27)(H,25,28) |
| InChIKey | OGLNLEGTZUABED-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 123.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |