C20H18IN5O2 — CID 91365344
3-amino-6-[[3-[[(4-iodobenzoyl)amino]methyl]phenyl]methyl]pyrazine-2-carboxamide (PubChem CID 91365344) has the molecular formula C20H18IN5O2 and a molecular weight of 487.30 g/mol. Its IUPAC name is 3-amino-6-[[3-[[(4-iodobenzoyl)amino]methyl]phenyl]methyl]pyrazine-2-carboxamide.
| Compound Name | 3-amino-6-[[3-[[(4-iodobenzoyl)amino]methyl]phenyl]methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 91365344 |
| Molecular Formula | C20H18IN5O2 |
| Molecular Weight | 487.30 g/mol |
| Exact Mass | 487.05 |
| IUPAC Name | 3-amino-6-[[3-[[(4-iodobenzoyl)amino]methyl]phenyl]methyl]pyrazine-2-carboxamide |
| SMILES | NC(=O)c1nc(Cc2cccc(CNC(=O)c3ccc(I)cc3)c2)cnc1N |
| InChI | InChI=1S/C20H18IN5O2/c21-15-6-4-14(5-7-15)20(28)25-10-13-3-1-2-12(8-13)9-16-11-24-18(22)17(26-16)19(23)27/h1-8,11H,9-10H2,(H2,22,24)(H2,23,27)(H,25,28) |
| InChIKey | NQVUWBXNKLMGSA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 123.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|