C25H37NSi — CID 91435067
(5,7-dimethyl-2,3,4,4a,5,5a,6,7,8,8a,9,9a-dodecahydro-1H-cyclopenta[g]quinolin-8-yl)-(1H-inden-1-yl)-dimethylsilane (PubChem CID 91435067) has the molecular formula C25H37NSi and a molecular weight of 379.66 g/mol. Its IUPAC name is (5,7-dimethyl-2,3,4,4a,5,5a,6,7,8,8a,9,9a-dodecahydro-1H-cyclopenta[g]quinolin-8-yl)-(1H-inden-1-yl)-dimethylsilane.
| Compound Name | (5,7-dimethyl-2,3,4,4a,5,5a,6,7,8,8a,9,9a-dodecahydro-1H-cyclopenta[g]quinolin-8-yl)-(1H-inden-1-yl)-dimethylsilane |
|---|---|
| PubChem CID | 91435067 |
| Molecular Formula | C25H37NSi |
| Molecular Weight | 379.66 g/mol |
| Exact Mass | 379.27 |
| IUPAC Name | (5,7-dimethyl-2,3,4,4a,5,5a,6,7,8,8a,9,9a-dodecahydro-1H-cyclopenta[g]quinolin-8-yl)-(1H-inden-1-yl)-dimethylsilane |
| SMILES | CC1CC2C(C)C3CCCNC3CC2C1[Si](C)(C)C1C=Cc2ccccc21 |
| InChI | InChI=1S/C25H37NSi/c1-16-14-21-17(2)19-10-7-13-26-23(19)15-22(21)25(16)27(3,4)24-12-11-18-8-5-6-9-20(18)24/h5-6,8-9,11-12,16-17,19,21-26H,7,10,13-15H2,1-4H3 |
| InChIKey | AXCLNUIRNQMAOV-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.66 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|