About 4-methyl-5-[(Z)-prop-1-enyl]-3,4-dihydro-2H-pyrrole
4-methyl-5-[(Z)-prop-1-enyl]-3,4-dihydro-2H-pyrrole (PubChem CID 91437753) has the molecular formula C8H13N
and a molecular weight of 123.20 g/mol. Its IUPAC name is 4-methyl-5-[(Z)-prop-1-enyl]-3,4-dihydro-2H-pyrrole.
Analyze 4-methyl-5-[(Z)-prop-1-enyl]-3,4-dihydro-2H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-5-[(Z)-prop-1-enyl]-3,4-dihydro-2H-pyrrole?
The IUPAC name of 4-methyl-5-[(Z)-prop-1-enyl]-3,4-dihydro-2H-pyrrole (CID 91437753) is 4-methyl-5-[(Z)-prop-1-enyl]-3,4-dihydro-2H-pyrrole.
What is the SMILES notation for 4-methyl-5-[(Z)-prop-1-enyl]-3,4-dihydro-2H-pyrrole?
The canonical SMILES for 4-methyl-5-[(Z)-prop-1-enyl]-3,4-dihydro-2H-pyrrole is C/C=C\C1=NCCC1C.
What is the InChIKey of 4-methyl-5-[(Z)-prop-1-enyl]-3,4-dihydro-2H-pyrrole?
The InChIKey is OZUITSISNGAASR-ARJAWSKDSA-N. The full InChI is InChI=1S/C8H13N/c1-3-4-8-7(2)5-6-9-8/h3-4,7H,5-6H2,1-2H3/b4-3-.
What are the key properties of 4-methyl-5-[(Z)-prop-1-enyl]-3,4-dihydro-2H-pyrrole?
4-methyl-5-[(Z)-prop-1-enyl]-3,4-dihydro-2H-pyrrole has a molecular weight of 123.20 g/mol, XLogP of 2.04, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-5-[(Z)-prop-1-enyl]-3,4-dihydro-2H-pyrrole is sourced from PubChem (CID 91437753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).