C14H24O3 — CID 91439148
(3E)-hexa-1,3-diene;2-(2-propyl-1,3-dioxolan-2-yl)acetaldehyde (PubChem CID 91439148) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is (3E)-hexa-1,3-diene;2-(2-propyl-1,3-dioxolan-2-yl)acetaldehyde.
| Compound Name | (3E)-hexa-1,3-diene;2-(2-propyl-1,3-dioxolan-2-yl)acetaldehyde |
|---|---|
| PubChem CID | 91439148 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (3E)-hexa-1,3-diene;2-(2-propyl-1,3-dioxolan-2-yl)acetaldehyde |
| SMILES | C=C/C=C/CC.CCCC1(CC=O)OCCO1 |
| InChI | InChI=1S/C8H14O3.C6H10/c1-2-3-8(4-5-9)10-6-7-11-8;1-3-5-6-4-2/h5H,2-4,6-7H2,1H3;3,5-6H,1,4H2,2H3/b;6-5+ |
| InChIKey | QVQNZGATCPTEPJ-MXDQRGINSA-N |
| XLogP | 3.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|