About 1-chloro-1-nitrosobutane
1-chloro-1-nitrosobutane (PubChem CID 91441735) has the molecular formula C4H8ClNO
and a molecular weight of 121.57 g/mol. Its IUPAC name is 1-chloro-1-nitrosobutane.
Molecular Properties
| Compound Name | 1-chloro-1-nitrosobutane |
| PubChem CID | 91441735 |
| Molecular Formula | C4H8ClNO |
| Molecular Weight | 121.57 g/mol |
| Exact Mass | 121.03 |
| IUPAC Name | 1-chloro-1-nitrosobutane |
| SMILES | CCCC(Cl)N=O |
| InChI | InChI=1S/C4H8ClNO/c1-2-3-4(5)6-7/h4H,2-3H2,1H3 |
| InChIKey | OUJLKAJRQZDPSJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.57 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-1-nitrosobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-1-nitrosobutane?
The IUPAC name of 1-chloro-1-nitrosobutane (CID 91441735) is 1-chloro-1-nitrosobutane.
What is the SMILES notation for 1-chloro-1-nitrosobutane?
The canonical SMILES for 1-chloro-1-nitrosobutane is CCCC(Cl)N=O.
What is the InChIKey of 1-chloro-1-nitrosobutane?
The InChIKey is OUJLKAJRQZDPSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8ClNO/c1-2-3-4(5)6-7/h4H,2-3H2,1H3.
What are the key properties of 1-chloro-1-nitrosobutane?
1-chloro-1-nitrosobutane has a molecular weight of 121.57 g/mol, XLogP of 2.12, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-1-nitrosobutane is sourced from PubChem (CID 91441735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).