About 3-chloro-2-nitrosohexane
3-chloro-2-nitrosohexane (PubChem CID 24821132) has the molecular formula C6H12ClNO
and a molecular weight of 149.62 g/mol. Its IUPAC name is 3-chloro-2-nitrosohexane.
Molecular Properties
| Compound Name | 3-chloro-2-nitrosohexane |
| PubChem CID | 24821132 |
| Molecular Formula | C6H12ClNO |
| Molecular Weight | 149.62 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 3-chloro-2-nitrosohexane |
| SMILES | CCCC(Cl)C(C)N=O |
| InChI | InChI=1S/C6H12ClNO/c1-3-4-6(7)5(2)8-9/h5-6H,3-4H2,1-2H3 |
| InChIKey | NRPWPCUWKQBMIG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.62 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2-nitrosohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2-nitrosohexane?
The IUPAC name of 3-chloro-2-nitrosohexane (CID 24821132) is 3-chloro-2-nitrosohexane.
What is the SMILES notation for 3-chloro-2-nitrosohexane?
The canonical SMILES for 3-chloro-2-nitrosohexane is CCCC(Cl)C(C)N=O.
What is the InChIKey of 3-chloro-2-nitrosohexane?
The InChIKey is NRPWPCUWKQBMIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12ClNO/c1-3-4-6(7)5(2)8-9/h5-6H,3-4H2,1-2H3.
What are the key properties of 3-chloro-2-nitrosohexane?
3-chloro-2-nitrosohexane has a molecular weight of 149.62 g/mol, XLogP of 2.55, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-nitrosohexane is sourced from PubChem (CID 24821132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).