C14H37N3OSi — CID 91442379
3-[3-aminopropyl(dimethyl)silyl]oxypropan-1-amine;N,N-diethylethanamine (PubChem CID 91442379) has the molecular formula C14H37N3OSi and a molecular weight of 291.56 g/mol. Its IUPAC name is 3-[3-aminopropyl(dimethyl)silyl]oxypropan-1-amine;N,N-diethylethanamine.
| Compound Name | 3-[3-aminopropyl(dimethyl)silyl]oxypropan-1-amine;N,N-diethylethanamine |
|---|---|
| PubChem CID | 91442379 |
| Molecular Formula | C14H37N3OSi |
| Molecular Weight | 291.56 g/mol |
| Exact Mass | 291.27 |
| IUPAC Name | 3-[3-aminopropyl(dimethyl)silyl]oxypropan-1-amine;N,N-diethylethanamine |
| SMILES | CCN(CC)CC.C[Si](C)(CCCN)OCCCN |
| InChI | InChI=1S/C8H22N2OSi.C6H15N/c1-12(2,8-4-6-10)11-7-3-5-9;1-4-7(5-2)6-3/h3-10H2,1-2H3;4-6H2,1-3H3 |
| InChIKey | ACNIJOSECDCHMH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.56 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|