C12H38N2O2Si3 — CID 162253178
3-[[3-aminopropyl(dimethyl)silyl]oxysilyloxy-dimethylsilyl]propan-1-amine;methane (PubChem CID 162253178) has the molecular formula C12H38N2O2Si3 and a molecular weight of 326.71 g/mol. Its IUPAC name is 3-[[3-aminopropyl(dimethyl)silyl]oxysilyloxy-dimethylsilyl]propan-1-amine;methane.
| Compound Name | 3-[[3-aminopropyl(dimethyl)silyl]oxysilyloxy-dimethylsilyl]propan-1-amine;methane |
|---|---|
| PubChem CID | 162253178 |
| Molecular Formula | C12H38N2O2Si3 |
| Molecular Weight | 326.71 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | 3-[[3-aminopropyl(dimethyl)silyl]oxysilyloxy-dimethylsilyl]propan-1-amine;methane |
| SMILES | C.C.C[Si](C)(CCCN)O[SiH2]O[Si](C)(C)CCCN |
| InChI | InChI=1S/C10H30N2O2Si3.2CH4/c1-16(2,9-5-7-11)13-15-14-17(3,4)10-6-8-12;;/h5-12,15H2,1-4H3;2*1H4 |
| InChIKey | ZYGFTDPUEQGKME-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.71 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|