C8H24OSi3 — CID 173093108
3-dimethylsilylpropyl-dimethyl-methylsilyloxysilane (PubChem CID 173093108) has the molecular formula C8H24OSi3 and a molecular weight of 220.54 g/mol. Its IUPAC name is 3-dimethylsilylpropyl-dimethyl-methylsilyloxysilane.
| Compound Name | 3-dimethylsilylpropyl-dimethyl-methylsilyloxysilane |
|---|---|
| PubChem CID | 173093108 |
| Molecular Formula | C8H24OSi3 |
| Molecular Weight | 220.54 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 3-dimethylsilylpropyl-dimethyl-methylsilyloxysilane |
| SMILES | C[SiH2]O[Si](C)(C)CCC[SiH](C)C |
| InChI | InChI=1S/C8H24OSi3/c1-10-9-12(4,5)8-6-7-11(2)3/h11H,6-8,10H2,1-5H3 |
| InChIKey | WWHGGHABFGUPCV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.54 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|