About argon;trimethyl(methylsilyloxy)silane
argon;trimethyl(methylsilyloxy)silane (PubChem CID 158013933) has the molecular formula C4H14ArOSi2
and a molecular weight of 174.27 g/mol. Its IUPAC name is argon;trimethyl(methylsilyloxy)silane.
Molecular Properties
| Compound Name | argon;trimethyl(methylsilyloxy)silane |
| PubChem CID | 158013933 |
| Molecular Formula | C4H14ArOSi2 |
| Molecular Weight | 174.27 g/mol |
| Exact Mass | 174.02 |
| IUPAC Name | argon;trimethyl(methylsilyloxy)silane |
| SMILES | C[SiH2]O[Si](C)(C)C.[Ar] |
| InChI | InChI=1S/C4H14OSi2.Ar/c1-6-5-7(2,3)4;/h6H2,1-4H3; |
| InChIKey | FFFPTUGVXSCTEU-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.27 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze argon;trimethyl(methylsilyloxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of argon;trimethyl(methylsilyloxy)silane?
The IUPAC name of argon;trimethyl(methylsilyloxy)silane (CID 158013933) is argon;trimethyl(methylsilyloxy)silane.
What is the SMILES notation for argon;trimethyl(methylsilyloxy)silane?
The canonical SMILES for argon;trimethyl(methylsilyloxy)silane is C[SiH2]O[Si](C)(C)C.[Ar].
What is the InChIKey of argon;trimethyl(methylsilyloxy)silane?
The InChIKey is FFFPTUGVXSCTEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H14OSi2.Ar/c1-6-5-7(2,3)4;/h6H2,1-4H3;.
What are the key properties of argon;trimethyl(methylsilyloxy)silane?
argon;trimethyl(methylsilyloxy)silane has a molecular weight of 174.27 g/mol, XLogP of 0.97, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for argon;trimethyl(methylsilyloxy)silane is sourced from PubChem (CID 158013933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).