About silyloxysilane;trimethyl(methylsilyloxy)silane
silyloxysilane;trimethyl(methylsilyloxy)silane (PubChem CID 172839935) has the molecular formula C4H20O2Si4
and a molecular weight of 212.55 g/mol. Its IUPAC name is silyloxysilane;trimethyl(methylsilyloxy)silane.
Molecular Properties
| Compound Name | silyloxysilane;trimethyl(methylsilyloxy)silane |
| PubChem CID | 172839935 |
| Molecular Formula | C4H20O2Si4 |
| Molecular Weight | 212.55 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | silyloxysilane;trimethyl(methylsilyloxy)silane |
| SMILES | C[SiH2]O[Si](C)(C)C.[SiH3]O[SiH3] |
| InChI | InChI=1S/C4H14OSi2.H6OSi2/c1-6-5-7(2,3)4;2-1-3/h6H2,1-4H3;2-3H3 |
| InChIKey | WQTGXYSKFYESGE-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.55 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze silyloxysilane;trimethyl(methylsilyloxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silyloxysilane;trimethyl(methylsilyloxy)silane?
The IUPAC name of silyloxysilane;trimethyl(methylsilyloxy)silane (CID 172839935) is silyloxysilane;trimethyl(methylsilyloxy)silane.
What is the SMILES notation for silyloxysilane;trimethyl(methylsilyloxy)silane?
The canonical SMILES for silyloxysilane;trimethyl(methylsilyloxy)silane is C[SiH2]O[Si](C)(C)C.[SiH3]O[SiH3].
What is the InChIKey of silyloxysilane;trimethyl(methylsilyloxy)silane?
The InChIKey is WQTGXYSKFYESGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H14OSi2.H6OSi2/c1-6-5-7(2,3)4;2-1-3/h6H2,1-4H3;2-3H3.
What are the key properties of silyloxysilane;trimethyl(methylsilyloxy)silane?
silyloxysilane;trimethyl(methylsilyloxy)silane has a molecular weight of 212.55 g/mol, XLogP of -1.47, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for silyloxysilane;trimethyl(methylsilyloxy)silane is sourced from PubChem (CID 172839935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).