C9H30O3Si4 — CID 123922485
[dimethyl(methylsilyloxy)silyl]oxy-ethyl-methyl-methylsilyloxysilane;ethane (PubChem CID 123922485) has the molecular formula C9H30O3Si4 and a molecular weight of 298.68 g/mol. Its IUPAC name is [dimethyl(methylsilyloxy)silyl]oxy-ethyl-methyl-methylsilyloxysilane;ethane.
| Compound Name | [dimethyl(methylsilyloxy)silyl]oxy-ethyl-methyl-methylsilyloxysilane;ethane |
|---|---|
| PubChem CID | 123922485 |
| Molecular Formula | C9H30O3Si4 |
| Molecular Weight | 298.68 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | [dimethyl(methylsilyloxy)silyl]oxy-ethyl-methyl-methylsilyloxysilane;ethane |
| SMILES | CC.CC[Si](C)(O[SiH2]C)O[Si](C)(C)O[SiH2]C |
| InChI | InChI=1S/C7H24O3Si4.C2H6/c1-7-14(6,9-12-3)10-13(4,5)8-11-2;1-2/h7,11-12H2,1-6H3;1-2H3 |
| InChIKey | JLGMCWSYJYPYIJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.68 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|