C10H32O4Si5 — CID 157127020
dimethylsilyloxy-(2-dimethylsilyloxyethyl-methyl-methylsilyloxysilyl)oxy-dimethylsilane (PubChem CID 157127020) has the molecular formula C10H32O4Si5 and a molecular weight of 356.79 g/mol. Its IUPAC name is dimethylsilyloxy-(2-dimethylsilyloxyethyl-methyl-methylsilyloxysilyl)oxy-dimethylsilane.
| Compound Name | dimethylsilyloxy-(2-dimethylsilyloxyethyl-methyl-methylsilyloxysilyl)oxy-dimethylsilane |
|---|---|
| PubChem CID | 157127020 |
| Molecular Formula | C10H32O4Si5 |
| Molecular Weight | 356.79 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | dimethylsilyloxy-(2-dimethylsilyloxyethyl-methyl-methylsilyloxysilyl)oxy-dimethylsilane |
| SMILES | C[SiH2]O[Si@@](C)(CCO[SiH](C)C)O[Si](C)(C)O[SiH](C)C |
| InChI | InChI=1S/C10H32O4Si5/c1-15-12-19(8,10-9-11-16(2)3)14-18(6,7)13-17(4)5/h16-17H,9-10,15H2,1-8H3/t19-/m1/s1 |
| InChIKey | LMFORWVQTPSKHB-LJQANCHMSA-N |
| XLogP | 1.93 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.79 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|