C7H24N2O2Si3 — CID 123686879
N'-[[[dimethyl(methylsilyloxy)silyl]oxy-dimethylsilyl]methyl]methanediamine (PubChem CID 123686879) has the molecular formula C7H24N2O2Si3 and a molecular weight of 252.54 g/mol. Its IUPAC name is N'-[[[dimethyl(methylsilyloxy)silyl]oxy-dimethylsilyl]methyl]methanediamine.
| Compound Name | N'-[[[dimethyl(methylsilyloxy)silyl]oxy-dimethylsilyl]methyl]methanediamine |
|---|---|
| PubChem CID | 123686879 |
| Molecular Formula | C7H24N2O2Si3 |
| Molecular Weight | 252.54 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | N'-[[[dimethyl(methylsilyloxy)silyl]oxy-dimethylsilyl]methyl]methanediamine |
| SMILES | C[SiH2]O[Si](C)(C)O[Si](C)(C)CNCN |
| InChI | InChI=1S/C7H24N2O2Si3/c1-12-10-14(4,5)11-13(2,3)7-9-6-8/h9H,6-8,12H2,1-5H3 |
| InChIKey | XPGVIQBNYDBAHX-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.54 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|