C28H68Cl2O8Si4 — CID 161472491
3-chloropropyl(dimethyl)silane;[3-chloropropyl(dimethyl)silyl] tripropan-2-yl silicate;hydroxy-tri(propan-2-yloxy)silane (PubChem CID 161472491) has the molecular formula C28H68Cl2O8Si4 and a molecular weight of 716.09 g/mol. Its IUPAC name is 3-chloropropyl(dimethyl)silane;[3-chloropropyl(dimethyl)silyl] tripropan-2-yl silicate;hydroxy-tri(propan-2-yloxy)silane.
| Compound Name | 3-chloropropyl(dimethyl)silane;[3-chloropropyl(dimethyl)silyl] tripropan-2-yl silicate;hydroxy-tri(propan-2-yloxy)silane |
|---|---|
| PubChem CID | 161472491 |
| Molecular Formula | C28H68Cl2O8Si4 |
| Molecular Weight | 716.09 g/mol |
| Exact Mass | 714.34 |
| IUPAC Name | 3-chloropropyl(dimethyl)silane;[3-chloropropyl(dimethyl)silyl] tripropan-2-yl silicate;hydroxy-tri(propan-2-yloxy)silane |
| SMILES | CC(C)O[Si](O)(OC(C)C)OC(C)C.CC(C)O[Si](OC(C)C)(OC(C)C)O[Si](C)(C)CCCCl.C[SiH](C)CCCCl |
| InChI | InChI=1S/C14H33ClO4Si2.C9H22O4Si.C5H13ClSi/c1-12(2)16-21(17-13(3)4,18-14(5)6)19-20(7,8)11-9-10-15;1-7(2)11-14(10,12-8(3)4)13-9(5)6;1-7(2)5-3-4-6/h12-14H,9-11H2,1-8H3;7-10H,1-6H3;7H,3-5H2,1-2H3 |
| InChIKey | WDGTZKIFXZSDNV-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.09 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|