C16H34BClO4Si — CID 71484184
3-chloropropyl-di(propan-2-yloxy)-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]silane (PubChem CID 71484184) has the molecular formula C16H34BClO4Si and a molecular weight of 364.80 g/mol. Its IUPAC name is 3-chloropropyl-di(propan-2-yloxy)-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]silane.
| Compound Name | 3-chloropropyl-di(propan-2-yloxy)-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]silane |
|---|---|
| PubChem CID | 71484184 |
| Molecular Formula | C16H34BClO4Si |
| Molecular Weight | 364.80 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 3-chloropropyl-di(propan-2-yloxy)-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]silane |
| SMILES | CC(C)O[Si](CCCCl)(CB1OC(C)(C)C(C)(C)O1)OC(C)C |
| InChI | InChI=1S/C16H34BClO4Si/c1-13(2)19-23(11-9-10-18,20-14(3)4)12-17-21-15(5,6)16(7,8)22-17/h13-14H,9-12H2,1-8H3 |
| InChIKey | ONFSLLLOSFNTCH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.80 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|