C16H32BClO3Si — CID 135062020
[(Z)-5-chloro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-1-en-2-yl]-dimethyl-propan-2-yloxysilane (PubChem CID 135062020) has the molecular formula C16H32BClO3Si and a molecular weight of 346.78 g/mol. Its IUPAC name is [(Z)-5-chloro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-1-en-2-yl]-dimethyl-propan-2-yloxysilane.
| Compound Name | [(Z)-5-chloro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-1-en-2-yl]-dimethyl-propan-2-yloxysilane |
|---|---|
| PubChem CID | 135062020 |
| Molecular Formula | C16H32BClO3Si |
| Molecular Weight | 346.78 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | [(Z)-5-chloro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-1-en-2-yl]-dimethyl-propan-2-yloxysilane |
| SMILES | CC(C)O[Si](C)(C)/C(=C\B1OC(C)(C)C(C)(C)O1)CCCCl |
| InChI | InChI=1S/C16H32BClO3Si/c1-13(2)19-22(7,8)14(10-9-11-18)12-17-20-15(3,4)16(5,6)21-17/h12-13H,9-11H2,1-8H3/b14-12- |
| InChIKey | HESJIFLGOBQNTH-OWBHPGMISA-N |
| XLogP | 4.73 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.78 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|