C11H24BClO3Si — CID 102217843
chloro-methyl-propan-2-yloxy-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]silane (PubChem CID 102217843) has the molecular formula C11H24BClO3Si and a molecular weight of 278.66 g/mol. Its IUPAC name is chloro-methyl-propan-2-yloxy-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]silane.
| Compound Name | chloro-methyl-propan-2-yloxy-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]silane |
|---|---|
| PubChem CID | 102217843 |
| Molecular Formula | C11H24BClO3Si |
| Molecular Weight | 278.66 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | chloro-methyl-propan-2-yloxy-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]silane |
| SMILES | CC(C)O[Si](C)(Cl)CB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C11H24BClO3Si/c1-9(2)14-17(7,13)8-12-15-10(3,4)11(5,6)16-12/h9H,8H2,1-7H3 |
| InChIKey | RCCWRQXOODYWTP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.66 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|