C10H20BClNO2- — CID 176700200
[(1R)-4-chloro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]azanide (PubChem CID 176700200) has the molecular formula C10H20BClNO2- and a molecular weight of 232.54 g/mol. Its IUPAC name is [(1R)-4-chloro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]azanide.
| Compound Name | [(1R)-4-chloro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]azanide |
|---|---|
| PubChem CID | 176700200 |
| Molecular Formula | C10H20BClNO2- |
| Molecular Weight | 232.54 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | [(1R)-4-chloro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]azanide |
| SMILES | CC1(C)OB([C@@H]([NH-])CCCCl)OC1(C)C |
| InChI | InChI=1S/C10H20BClNO2/c1-9(2)10(3,4)15-11(14-9)8(13)6-5-7-12/h8,13H,5-7H2,1-4H3/q-1/t8-/m0/s1 |
| InChIKey | GBSPQVNQEZBOTN-QMMMGPOBSA-N |
| XLogP | 3.06 |
| TPSA | 42.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.54 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|