C12H26BNO2 — CID 175053439
(1R)-N,N-dimethyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-1-amine (PubChem CID 175053439) has the molecular formula C12H26BNO2 and a molecular weight of 227.16 g/mol. Its IUPAC name is (1R)-N,N-dimethyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-1-amine.
| Compound Name | (1R)-N,N-dimethyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-1-amine |
|---|---|
| PubChem CID | 175053439 |
| Molecular Formula | C12H26BNO2 |
| Molecular Weight | 227.16 g/mol |
| Exact Mass | 227.21 |
| IUPAC Name | (1R)-N,N-dimethyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-1-amine |
| SMILES | CCC[C@@H](B1OC(C)(C)C(C)(C)O1)N(C)C |
| InChI | InChI=1S/C12H26BNO2/c1-8-9-10(14(6)7)13-15-11(2,3)12(4,5)16-13/h10H,8-9H2,1-7H3/t10-/m0/s1 |
| InChIKey | YSVUZOHVOMUXPU-JTQLQIEISA-N |
| XLogP | 2.35 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.16 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|