C9H19NO — CID 141353079
N,N-dimethyl-1-(2-methyloxiran-2-yl)butan-1-amine (PubChem CID 141353079) has the molecular formula C9H19NO and a molecular weight of 157.26 g/mol. Its IUPAC name is N,N-dimethyl-1-(2-methyloxiran-2-yl)butan-1-amine.
| Compound Name | N,N-dimethyl-1-(2-methyloxiran-2-yl)butan-1-amine |
|---|---|
| PubChem CID | 141353079 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | N,N-dimethyl-1-(2-methyloxiran-2-yl)butan-1-amine |
| SMILES | CCCC(N(C)C)C1(C)CO1 |
| InChI | InChI=1S/C9H19NO/c1-5-6-8(10(3)4)9(2)7-11-9/h8H,5-7H2,1-4H3 |
| InChIKey | SBAZXDRAEDZMAA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 15.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|