About [hydroxy-bis(4-methylpentan-2-yloxy)silyl] tris(4-methylpentan-2-yl) silicate
[hydroxy-bis(4-methylpentan-2-yloxy)silyl] tris(4-methylpentan-2-yl) silicate (PubChem CID 160843506) has the molecular formula C30H66O7Si2
and a molecular weight of 595.02 g/mol. Its IUPAC name is [hydroxy-bis(4-methylpentan-2-yloxy)silyl] tris(4-methylpentan-2-yl) silicate.
Molecular Properties
| Compound Name | [hydroxy-bis(4-methylpentan-2-yloxy)silyl] tris(4-methylpentan-2-yl) silicate |
| PubChem CID | 160843506 |
| Molecular Formula | C30H66O7Si2 |
| Molecular Weight | 595.02 g/mol |
| Exact Mass | 594.43 |
| IUPAC Name | [hydroxy-bis(4-methylpentan-2-yloxy)silyl] tris(4-methylpentan-2-yl) silicate |
| SMILES | CC(C)CC(C)O[Si](O)(OC(C)CC(C)C)O[Si](OC(C)CC(C)C)(OC(C)CC(C)C)OC(C)CC(C)C |
| InChI | InChI=1S/C30H66O7Si2/c1-21(2)16-26(11)32-38(31,33-27(12)17-22(3)4)37-39(34-28(13)18-23(5)6,35-29(14)19-24(7)8)36-30(15)20-25(9)10/h21-31H,16-20H2,1-15H3 |
| InChIKey | SIIMAYRGTRVFJR-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 595.02 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [hydroxy-bis(4-methylpentan-2-yloxy)silyl] tris(4-methylpentan-2-yl) silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [hydroxy-bis(4-methylpentan-2-yloxy)silyl] tris(4-methylpentan-2-yl) silicate?
The IUPAC name of [hydroxy-bis(4-methylpentan-2-yloxy)silyl] tris(4-methylpentan-2-yl) silicate (CID 160843506) is [hydroxy-bis(4-methylpentan-2-yloxy)silyl] tris(4-methylpentan-2-yl) silicate.
What is the SMILES notation for [hydroxy-bis(4-methylpentan-2-yloxy)silyl] tris(4-methylpentan-2-yl) silicate?
The canonical SMILES for [hydroxy-bis(4-methylpentan-2-yloxy)silyl] tris(4-methylpentan-2-yl) silicate is CC(C)CC(C)O[Si](O)(OC(C)CC(C)C)O[Si](OC(C)CC(C)C)(OC(C)CC(C)C)OC(C)CC(C)C.
What is the InChIKey of [hydroxy-bis(4-methylpentan-2-yloxy)silyl] tris(4-methylpentan-2-yl) silicate?
The InChIKey is SIIMAYRGTRVFJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H66O7Si2/c1-21(2)16-26(11)32-38(31,33-27(12)17-22(3)4)37-39(34-28(13)18-23(5)6,35-29(14)19-24(7)8)36-30(15)20-25(9)10/h21-31H,16-20H2,1-15H3.
What are the key properties of [hydroxy-bis(4-methylpentan-2-yloxy)silyl] tris(4-methylpentan-2-yl) silicate?
[hydroxy-bis(4-methylpentan-2-yloxy)silyl] tris(4-methylpentan-2-yl) silicate has a molecular weight of 595.02 g/mol, XLogP of 8.12, 22 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [hydroxy-bis(4-methylpentan-2-yloxy)silyl] tris(4-methylpentan-2-yl) silicate is sourced from PubChem (CID 160843506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).